C24H20BrN3O3S — CID 44942006
N-(6-bromo-1,3-benzothiazol-2-yl)-3,5-dimethoxy-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 44942006) has the molecular formula C24H20BrN3O3S and a molecular weight of 510.41 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-3,5-dimethoxy-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3,5-dimethoxy-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942006 |
| Molecular Formula | C24H20BrN3O3S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3,5-dimethoxy-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(/N=C/c2ccc(C)cc2)c2nc3ccc(Br)cc3s2)c1 |
| InChI | InChI=1S/C24H20BrN3O3S/c1-15-4-6-16(7-5-15)14-26-28(24-27-21-9-8-18(25)12-22(21)32-24)23(29)17-10-19(30-2)13-20(11-17)31-3/h4-14H,1-3H3/b26-14+ |
| InChIKey | PPXREMZVVUMCIX-VULFUBBASA-N |
| XLogP | 6.07 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|