C23H18BrN3OS — CID 44943989
N-[(E)-(4-bromophenyl)methylideneamino]-3-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44943989) has the molecular formula C23H18BrN3OS and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-3-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-3-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44943989 |
| Molecular Formula | C23H18BrN3OS |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-3-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1cccc(C(=O)N(/N=C/c2ccc(Br)cc2)c2nc3ccc(C)cc3s2)c1 |
| InChI | InChI=1S/C23H18BrN3OS/c1-15-4-3-5-18(12-15)22(28)27(25-14-17-7-9-19(24)10-8-17)23-26-20-11-6-16(2)13-21(20)29-23/h3-14H,1-2H3/b25-14+ |
| InChIKey | VZQAEPHRTCSOLA-AFUMVMLFSA-N |
| XLogP | 6.36 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|