C30H31BrN4O6S2 — CID 44941739
4-(azepan-1-ylsulfonyl)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44941739) has the molecular formula C30H31BrN4O6S2 and a molecular weight of 687.64 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941739 |
| Molecular Formula | C30H31BrN4O6S2 |
| Molecular Weight | 687.64 g/mol |
| Exact Mass | 686.09 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c2nc3ccc(Br)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C30H31BrN4O6S2/c1-39-25-16-20(17-26(40-2)28(25)41-3)19-32-35(30-33-24-13-10-22(31)18-27(24)42-30)29(36)21-8-11-23(12-9-21)43(37,38)34-14-6-4-5-7-15-34/h8-13,16-19H,4-7,14-15H2,1-3H3/b32-19+ |
| InChIKey | QUBAYWXOLNVNEW-BIZUNTBRSA-N |
| XLogP | 6.33 |
| TPSA | 110.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|