C31H33BrN4O6S2 — CID 44941787
N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44941787) has the molecular formula C31H33BrN4O6S2 and a molecular weight of 701.67 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941787 |
| Molecular Formula | C31H33BrN4O6S2 |
| Molecular Weight | 701.67 g/mol |
| Exact Mass | 700.10 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(C(=O)N(/N=C/c2cc(OC)c(OC)c(OC)c2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C31H33BrN4O6S2/c1-5-23-8-6-7-15-35(23)44(38,39)24-12-9-21(10-13-24)30(37)36(31-34-25-14-11-22(32)18-28(25)43-31)33-19-20-16-26(40-2)29(42-4)27(17-20)41-3/h9-14,16-19,23H,5-8,15H2,1-4H3/b33-19+ |
| InChIKey | FOHXYFHTGAHRKV-HNSNBQBZSA-N |
| XLogP | 6.72 |
| TPSA | 110.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|