C21H17N3O2S — CID 7543571
N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenylacetamide (PubChem CID 7543571) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenylacetamide.
| Compound Name | N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 7543571 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenylacetamide |
| SMILES | Cc1ccc2nc(N(/N=C\c3ccco3)C(=O)Cc3ccccc3)sc2c1 |
| InChI | InChI=1S/C21H17N3O2S/c1-15-9-10-18-19(12-15)27-21(23-18)24(22-14-17-8-5-11-26-17)20(25)13-16-6-3-2-4-7-16/h2-12,14H,13H2,1H3/b22-14- |
| InChIKey | PHWUBUQLYUKVJQ-HMAPJEAMSA-N |
| XLogP | 4.81 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|