C22H16ClN3O3S — CID 44945527
(E)-3-(2-chlorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 44945527) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 44945527 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccco3)C(=O)/C=C/c3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C22H16ClN3O3S/c1-28-16-9-10-19-20(13-16)30-22(25-19)26(24-14-17-6-4-12-29-17)21(27)11-8-15-5-2-3-7-18(15)23/h2-14H,1H3/b11-8+,24-14+ |
| InChIKey | RAGQTUCVUCRLTP-AGPUXGRSSA-N |
| XLogP | 5.63 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|