C24H13FN4O5S — CID 44943806
N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 44943806) has the molecular formula C24H13FN4O5S and a molecular weight of 488.46 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943806 |
| Molecular Formula | C24H13FN4O5S |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N(/N=C/c1coc2ccccc2c1=O)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C24H13FN4O5S/c25-16-8-9-19-21(11-16)35-24(27-19)28(23(31)14-4-3-5-17(10-14)29(32)33)26-12-15-13-34-20-7-2-1-6-18(20)22(15)30/h1-13H/b26-12+ |
| InChIKey | ZXHRMJSPYZLPNS-RPPGKUMJSA-N |
| XLogP | 5.13 |
| TPSA | 118.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|