C29H23FN4O5S2 — CID 44943820
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 44943820) has the molecular formula C29H23FN4O5S2 and a molecular weight of 590.66 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 44943820 |
| Molecular Formula | C29H23FN4O5S2 |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCCC2)cc1)N(/N=C/c1coc2ccccc2c1=O)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C29H23FN4O5S2/c30-21-10-13-24-26(16-21)40-29(32-24)34(31-17-20-18-39-25-7-3-2-6-23(25)27(20)35)28(36)19-8-11-22(12-9-19)41(37,38)33-14-4-1-5-15-33/h2-3,6-13,16-18H,1,4-5,14-15H2/b31-17+ |
| InChIKey | XFWFEGAYYDFQBW-KBVAKVRCSA-N |
| XLogP | 5.40 |
| TPSA | 113.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|