C20H10FN5O4S2 — CID 44943789
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 44943789) has the molecular formula C20H10FN5O4S2 and a molecular weight of 467.46 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44943789 |
| Molecular Formula | C20H10FN5O4S2 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(c1ccc2ncsc2c1)N(/N=C/c1ccc([N+](=O)[O-])o1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C20H10FN5O4S2/c21-12-2-5-15-17(8-12)32-20(24-15)25(23-9-13-3-6-18(30-13)26(28)29)19(27)11-1-4-14-16(7-11)31-10-22-14/h1-10H/b23-9+ |
| InChIKey | JTNJPMZBAIZKQO-NUGSKGIGSA-N |
| XLogP | 5.23 |
| TPSA | 114.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|