C20H13FN4O4S — CID 44944654
N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide (PubChem CID 44944654) has the molecular formula C20H13FN4O4S and a molecular weight of 424.41 g/mol. Its IUPAC name is N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 44944654 |
| Molecular Formula | C20H13FN4O4S |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc(F)cc3)C(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C20H13FN4O4S/c1-12-2-7-15-17(10-12)30-20(23-15)24(22-11-13-3-5-14(21)6-4-13)19(26)16-8-9-18(29-16)25(27)28/h2-11H,1H3/b22-11+ |
| InChIKey | NQRSIJKZGUNVCX-SSDVNMTOSA-N |
| XLogP | 4.93 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|