C25H23BrN4O4S3 — CID 44941988
N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44941988) has the molecular formula C25H23BrN4O4S3 and a molecular weight of 619.59 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44941988 |
| Molecular Formula | C25H23BrN4O4S3 |
| Molecular Weight | 619.59 g/mol |
| Exact Mass | 618.01 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2cccs2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C25H23BrN4O4S3/c1-29(16-19-4-2-12-34-19)37(32,33)21-9-6-17(7-10-21)24(31)30(27-15-20-5-3-13-35-20)25-28-22-11-8-18(26)14-23(22)36-25/h3,5-11,13-15,19H,2,4,12,16H2,1H3/b27-15+ |
| InChIKey | FAMNVTMNSUDLFC-JFLMPSFJSA-N |
| XLogP | 5.60 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|