C29H30N4O5S2 — CID 44945746
N-(6-methoxy-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 44945746) has the molecular formula C29H30N4O5S2 and a molecular weight of 578.72 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945746 |
| Molecular Formula | C29H30N4O5S2 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc(C)cc3)C(=O)c3ccc(S(=O)(=O)N(C)CC4CCCO4)cc3)sc2c1 |
| InChI | InChI=1S/C29H30N4O5S2/c1-20-6-8-21(9-7-20)18-30-33(29-31-26-15-12-23(37-3)17-27(26)39-29)28(34)22-10-13-25(14-11-22)40(35,36)32(2)19-24-5-4-16-38-24/h6-15,17-18,24H,4-5,16,19H2,1-3H3/b30-18+ |
| InChIKey | GOBGIAIJHVPTQV-UXHLAJHPSA-N |
| XLogP | 5.09 |
| TPSA | 101.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|