C17H10ClN3O2S2 — CID 7543282
N-(1,3-benzothiazol-2-yl)-5-chloro-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide (PubChem CID 7543282) has the molecular formula C17H10ClN3O2S2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-chloro-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-chloro-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7543282 |
| Molecular Formula | C17H10ClN3O2S2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-chloro-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)s1)N(/N=C\c1ccco1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H10ClN3O2S2/c18-15-8-7-14(24-15)16(22)21(19-10-11-4-3-9-23-11)17-20-12-5-1-2-6-13(12)25-17/h1-10H/b19-10- |
| InChIKey | FZNRGOYISLWZFG-GRSHGNNSSA-N |
| XLogP | 5.29 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|