C22H12BrFN4OS2 — CID 44942220
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-2-carboxamide (PubChem CID 44942220) has the molecular formula C22H12BrFN4OS2 and a molecular weight of 511.40 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 44942220 |
| Molecular Formula | C22H12BrFN4OS2 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(c1nc2ccccc2s1)N(/N=C/c1ccc(F)cc1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C22H12BrFN4OS2/c23-14-7-10-17-19(11-14)31-22(27-17)28(25-12-13-5-8-15(24)9-6-13)21(29)20-26-16-3-1-2-4-18(16)30-20/h1-12H/b25-12+ |
| InChIKey | FCEGMAVRFSBUIO-BRJLIKDPSA-N |
| XLogP | 6.49 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|