C21H13BrIN3OS — CID 44941481
N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2-iodobenzamide (PubChem CID 44941481) has the molecular formula C21H13BrIN3OS and a molecular weight of 562.23 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2-iodobenzamide.
| Compound Name | N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 44941481 |
| Molecular Formula | C21H13BrIN3OS |
| Molecular Weight | 562.23 g/mol |
| Exact Mass | 560.90 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2-iodobenzamide |
| SMILES | O=C(c1ccccc1I)N(/N=C/c1ccccc1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C21H13BrIN3OS/c22-15-10-11-18-19(12-15)28-21(25-18)26(24-13-14-6-2-1-3-7-14)20(27)16-8-4-5-9-17(16)23/h1-13H/b24-13+ |
| InChIKey | MSKLYJZBHIHEJW-ZMOGYAJESA-N |
| XLogP | 6.34 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.23 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|