C23H16BrN3O3S — CID 44941483
N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 44941483) has the molecular formula C23H16BrN3O3S and a molecular weight of 494.37 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 44941483 |
| Molecular Formula | C23H16BrN3O3S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(6-bromo-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(C1COc2ccccc2O1)N(/N=C/c1ccccc1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C23H16BrN3O3S/c24-16-10-11-17-21(12-16)31-23(26-17)27(25-13-15-6-2-1-3-7-15)22(28)20-14-29-18-8-4-5-9-19(18)30-20/h1-13,20H,14H2/b25-13+ |
| InChIKey | SWNGAFZBIXMTGS-DHRITJCHSA-N |
| XLogP | 5.27 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|