C24H18N4O5S — CID 44944602
N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 44944602) has the molecular formula C24H18N4O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 44944602 |
| Molecular Formula | C24H18N4O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])cc3)C(=O)C3COc4ccccc4O3)sc2c1 |
| InChI | InChI=1S/C24H18N4O5S/c1-15-6-11-18-22(12-15)34-24(26-18)27(25-13-16-7-9-17(10-8-16)28(30)31)23(29)21-14-32-19-4-2-3-5-20(19)33-21/h2-13,21H,14H2,1H3/b25-13+ |
| InChIKey | YZZPCLUXJPLHCJ-DHRITJCHSA-N |
| XLogP | 4.72 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|