C23H17N3O5S — CID 4787357
N-(4-acetylphenyl)-N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide (PubChem CID 4787357) has the molecular formula C23H17N3O5S and a molecular weight of 447.47 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide.
| Compound Name | N-(4-acetylphenyl)-N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 4787357 |
| Molecular Formula | C23H17N3O5S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-(4-acetylphenyl)-N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)N(c2ccc(C(C)=O)cc2)c2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17N3O5S/c1-14(27)15-7-10-17(11-8-15)25(23-24-18-5-3-4-6-21(18)32-23)22(28)16-9-12-20(31-2)19(13-16)26(29)30/h3-13H,1-2H3 |
| InChIKey | GYVKEAQLWBXUNP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|