C21H10Cl4N2O2S — CID 4625786
N-(1,3-benzothiazol-2-yl)-2,6-dichloro-N-(2,6-dichlorobenzoyl)benzamide (PubChem CID 4625786) has the molecular formula C21H10Cl4N2O2S and a molecular weight of 496.20 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2,6-dichloro-N-(2,6-dichlorobenzoyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2,6-dichloro-N-(2,6-dichlorobenzoyl)benzamide |
|---|---|
| PubChem CID | 4625786 |
| Molecular Formula | C21H10Cl4N2O2S |
| Molecular Weight | 496.20 g/mol |
| Exact Mass | 493.92 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2,6-dichloro-N-(2,6-dichlorobenzoyl)benzamide |
| SMILES | O=C(c1c(Cl)cccc1Cl)N(C(=O)c1c(Cl)cccc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H10Cl4N2O2S/c22-11-5-3-6-12(23)17(11)19(28)27(20(29)18-13(24)7-4-8-14(18)25)21-26-15-9-1-2-10-16(15)30-21/h1-10H |
| InChIKey | ZANFWVMFENSEPZ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.20 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|