C21H15Cl2N3O2S — CID 142980039
N-[4-(aminomethoxy)phenyl]-N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide (PubChem CID 142980039) has the molecular formula C21H15Cl2N3O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[4-(aminomethoxy)phenyl]-N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide.
| Compound Name | N-[4-(aminomethoxy)phenyl]-N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 142980039 |
| Molecular Formula | C21H15Cl2N3O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | N-[4-(aminomethoxy)phenyl]-N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide |
| SMILES | NCOc1ccc(N(C(=O)c2ccc(Cl)cc2Cl)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O2S/c22-13-5-10-16(17(23)11-13)20(27)26(14-6-8-15(9-7-14)28-12-24)21-25-18-3-1-2-4-19(18)29-21/h1-11H,12,24H2 |
| InChIKey | OTPAVFMFDVSIIF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|