C27H23N3O4S — CID 55381075
N-(1,3-benzothiazol-2-yl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethoxyphenyl)benzamide (PubChem CID 55381075) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 55381075 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(N(C(=O)c2ccc(CN3C(=O)CCC3=O)cc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C27H23N3O4S/c1-2-34-21-13-11-20(12-14-21)30(27-28-22-5-3-4-6-23(22)35-27)26(33)19-9-7-18(8-10-19)17-29-24(31)15-16-25(29)32/h3-14H,2,15-17H2,1H3 |
| InChIKey | YZRRBTGXDVPRTO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|