C30H21N3O4S — CID 166184992
N-(1,3-benzothiazol-2-yl)-3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methoxyphenyl)benzamide (PubChem CID 166184992) has the molecular formula C30H21N3O4S and a molecular weight of 519.58 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methoxyphenyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 166184992 |
| Molecular Formula | C30H21N3O4S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(N(C(=O)c2cccc(CN3C(=O)c4ccccc4C3=O)c2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C30H21N3O4S/c1-37-22-11-7-10-21(17-22)33(30-31-25-14-4-5-15-26(25)38-30)27(34)20-9-6-8-19(16-20)18-32-28(35)23-12-2-3-13-24(23)29(32)36/h2-17H,18H2,1H3 |
| InChIKey | JUUWJOZSPJZCQL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|