About CID 134840608
CID 134840608 (PubChem CID 134840608) has the molecular formula C15H22NO2
and a molecular weight of 248.35 g/mol.
Molecular Properties
| Compound Name | CID 134840608 |
| PubChem CID | 134840608 |
| Molecular Formula | C15H22NO2 |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | — |
| SMILES | CCOC(C)C[C](C)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C15H22NO2/c1-5-18-13(3)11-12(2)15(17)16(4)14-9-7-6-8-10-14/h6-10,13H,5,11H2,1-4H3 |
| InChIKey | XYRXDWQSXYKUQX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 134840608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134840608?
The IUPAC name of CID 134840608 (CID 134840608) is not available.
What is the SMILES notation for CID 134840608?
The canonical SMILES for CID 134840608 is CCOC(C)C[C](C)C(=O)N(C)c1ccccc1.
What is the InChIKey of CID 134840608?
The InChIKey is XYRXDWQSXYKUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22NO2/c1-5-18-13(3)11-12(2)15(17)16(4)14-9-7-6-8-10-14/h6-10,13H,5,11H2,1-4H3.
What are the key properties of CID 134840608?
CID 134840608 has a molecular weight of 248.35 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134840608 is sourced from PubChem (CID 134840608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).