About sodium;diphenylmethanone;2-ethoxypropan-1-olate
sodium;diphenylmethanone;2-ethoxypropan-1-olate (PubChem CID 23675703) has the molecular formula C18H21NaO3
and a molecular weight of 308.35 g/mol. Its IUPAC name is sodium;diphenylmethanone;2-ethoxypropan-1-olate.
Molecular Properties
| Compound Name | sodium;diphenylmethanone;2-ethoxypropan-1-olate |
| PubChem CID | 23675703 |
| Molecular Formula | C18H21NaO3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | sodium;diphenylmethanone;2-ethoxypropan-1-olate |
| SMILES | CCOC(C)C[O-].O=C(c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C13H10O.C5H11O2.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-5(2)4-6;/h1-10H;5H,3-4H2,1-2H3;/q;-1;+1 |
| InChIKey | VLDZMXOTVDLYON-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;diphenylmethanone;2-ethoxypropan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;diphenylmethanone;2-ethoxypropan-1-olate?
The IUPAC name of sodium;diphenylmethanone;2-ethoxypropan-1-olate (CID 23675703) is sodium;diphenylmethanone;2-ethoxypropan-1-olate.
What is the SMILES notation for sodium;diphenylmethanone;2-ethoxypropan-1-olate?
The canonical SMILES for sodium;diphenylmethanone;2-ethoxypropan-1-olate is CCOC(C)C[O-].O=C(c1ccccc1)c1ccccc1.[Na+].
What is the InChIKey of sodium;diphenylmethanone;2-ethoxypropan-1-olate?
The InChIKey is VLDZMXOTVDLYON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C5H11O2.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-5(2)4-6;/h1-10H;5H,3-4H2,1-2H3;/q;-1;+1.
What are the key properties of sodium;diphenylmethanone;2-ethoxypropan-1-olate?
sodium;diphenylmethanone;2-ethoxypropan-1-olate has a molecular weight of 308.35 g/mol, XLogP of -0.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;diphenylmethanone;2-ethoxypropan-1-olate is sourced from PubChem (CID 23675703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).