C17H17Cl3N2O2 — CID 162411860
2,2,2-trichloroethyl N-[(N-benzylanilino)methyl]carbamate (PubChem CID 162411860) has the molecular formula C17H17Cl3N2O2 and a molecular weight of 387.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(N-benzylanilino)methyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(N-benzylanilino)methyl]carbamate |
|---|---|
| PubChem CID | 162411860 |
| Molecular Formula | C17H17Cl3N2O2 |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(N-benzylanilino)methyl]carbamate |
| SMILES | O=C(NCN(Cc1ccccc1)c1ccccc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H17Cl3N2O2/c18-17(19,20)12-24-16(23)21-13-22(15-9-5-2-6-10-15)11-14-7-3-1-4-8-14/h1-10H,11-13H2,(H,21,23) |
| InChIKey | DLRSYCVRHWUSTH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|