C12H15Cl3N2O3 — CID 162411671
2,2,2-trichloroethyl N-[(2-methoxy-N-methylanilino)methyl]carbamate (PubChem CID 162411671) has the molecular formula C12H15Cl3N2O3 and a molecular weight of 341.62 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2-methoxy-N-methylanilino)methyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2-methoxy-N-methylanilino)methyl]carbamate |
|---|---|
| PubChem CID | 162411671 |
| Molecular Formula | C12H15Cl3N2O3 |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2-methoxy-N-methylanilino)methyl]carbamate |
| SMILES | COc1ccccc1N(C)CNC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3N2O3/c1-17(9-5-3-4-6-10(9)19-2)8-16-11(18)20-7-12(13,14)15/h3-6H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | ILCFAEZFXSFMHM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|