3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid

C11H10Cl3NO5 — CID 22046696

IUPAC3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid
SMILESCOc1cccc(C(=O)O)c1NC(=O)OCC(Cl)(Cl)Cl
InChIInChI=1S/C11H10Cl3NO5/c1-19-7-4-2-3-6(9(16)17)8(7)15-10(18)20-5-11(12,13)14/h2-4H,5H2,1H3,(H,15,18)(H,16,17)
InChIKeyRSDAUKJLYXGDMD-UHFFFAOYSA-N
MW342.56 g/mol
LogP3.31
Rot. Bonds4

About 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid

3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid (PubChem CID 22046696) has the molecular formula C11H10Cl3NO5 and a molecular weight of 342.56 g/mol. Its IUPAC name is 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid.

Molecular Properties

Compound Name3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid
PubChem CID22046696
Molecular FormulaC11H10Cl3NO5
Molecular Weight342.56 g/mol
Exact Mass340.96
IUPAC Name3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid
SMILESCOc1cccc(C(=O)O)c1NC(=O)OCC(Cl)(Cl)Cl
InChIInChI=1S/C11H10Cl3NO5/c1-19-7-4-2-3-6(9(16)17)8(7)15-10(18)20-5-11(12,13)14/h2-4H,5H2,1H3,(H,15,18)(H,16,17)
InChIKeyRSDAUKJLYXGDMD-UHFFFAOYSA-N
XLogP3.31
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.56
LogP ≤ 53.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid?
The IUPAC name of 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid (CID 22046696) is 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid.
What is the SMILES notation for 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid?
The canonical SMILES for 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid is COc1cccc(C(=O)O)c1NC(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid?
The InChIKey is RSDAUKJLYXGDMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl3NO5/c1-19-7-4-2-3-6(9(16)17)8(7)15-10(18)20-5-11(12,13)14/h2-4H,5H2,1H3,(H,15,18)(H,16,17).
What are the key properties of 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid?
3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid has a molecular weight of 342.56 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid is sourced from PubChem (CID 22046696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).