C11H10Cl3NO5 — CID 22046696
3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid (PubChem CID 22046696) has the molecular formula C11H10Cl3NO5 and a molecular weight of 342.56 g/mol. Its IUPAC name is 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid.
| Compound Name | 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 22046696 |
| Molecular Formula | C11H10Cl3NO5 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 3-methoxy-2-(2,2,2-trichloroethoxycarbonylamino)benzoic acid |
| SMILES | COc1cccc(C(=O)O)c1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO5/c1-19-7-4-2-3-6(9(16)17)8(7)15-10(18)20-5-11(12,13)14/h2-4H,5H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | RSDAUKJLYXGDMD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|