3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid

C10H7ClF3NO4 — CID 107049052

IUPAC3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid
SMILESO=C(Nc1c(Cl)cccc1C(=O)O)OCC(F)(F)F
InChIInChI=1S/C10H7ClF3NO4/c11-6-3-1-2-5(8(16)17)7(6)15-9(18)19-4-10(12,13)14/h1-3H,4H2,(H,15,18)(H,16,17)
InChIKeyOHTKDNBFGIJFGL-UHFFFAOYSA-N
MW297.62 g/mol
LogP3.15
Rot. Bonds3

About 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid

3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid (PubChem CID 107049052) has the molecular formula C10H7ClF3NO4 and a molecular weight of 297.62 g/mol. Its IUPAC name is 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid.

Molecular Properties

Compound Name3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid
PubChem CID107049052
Molecular FormulaC10H7ClF3NO4
Molecular Weight297.62 g/mol
Exact Mass297.00
IUPAC Name3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid
SMILESO=C(Nc1c(Cl)cccc1C(=O)O)OCC(F)(F)F
InChIInChI=1S/C10H7ClF3NO4/c11-6-3-1-2-5(8(16)17)7(6)15-9(18)19-4-10(12,13)14/h1-3H,4H2,(H,15,18)(H,16,17)
InChIKeyOHTKDNBFGIJFGL-UHFFFAOYSA-N
XLogP3.15
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.62
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid?
The IUPAC name of 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid (CID 107049052) is 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid.
What is the SMILES notation for 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid?
The canonical SMILES for 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid is O=C(Nc1c(Cl)cccc1C(=O)O)OCC(F)(F)F.
What is the InChIKey of 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid?
The InChIKey is OHTKDNBFGIJFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClF3NO4/c11-6-3-1-2-5(8(16)17)7(6)15-9(18)19-4-10(12,13)14/h1-3H,4H2,(H,15,18)(H,16,17).
What are the key properties of 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid?
3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid has a molecular weight of 297.62 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid is sourced from PubChem (CID 107049052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).