C26H37NO4Si — CID 134878181
benzyl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethylfuran-2-yl)propan-2-yl]-N-prop-2-ynylcarbamate (PubChem CID 134878181) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethylfuran-2-yl)propan-2-yl]-N-prop-2-ynylcarbamate.
| Compound Name | benzyl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethylfuran-2-yl)propan-2-yl]-N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 134878181 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | benzyl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethylfuran-2-yl)propan-2-yl]-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(C(=O)OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)Cc1ccc(CC)o1 |
| InChI | InChI=1S/C26H37NO4Si/c1-8-17-27(25(28)29-19-21-13-11-10-12-14-21)22(18-24-16-15-23(9-2)31-24)20-30-32(6,7)26(3,4)5/h1,10-16,22H,9,17-20H2,2-7H3/t22-/m1/s1 |
| InChIKey | GUMBACUZTCJIDN-JOCHJYFZSA-N |
| XLogP | 6.05 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|