C18H23NO4S — CID 95368060
N-[(2R)-2-hydroxy-2-phenylpropyl]-2-(4-methoxyphenyl)ethanesulfonamide (PubChem CID 95368060) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-phenylpropyl]-2-(4-methoxyphenyl)ethanesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-2-phenylpropyl]-2-(4-methoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 95368060 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-phenylpropyl]-2-(4-methoxyphenyl)ethanesulfonamide |
| SMILES | COc1ccc(CCS(=O)(=O)NC[C@](C)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23NO4S/c1-18(20,16-6-4-3-5-7-16)14-19-24(21,22)13-12-15-8-10-17(23-2)11-9-15/h3-11,19-20H,12-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | ILGIPKXXVQFQIR-SFHVURJKSA-N |
| XLogP | 2.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |