C34H34O5 — CID 70232773
2-[6-[4-(4-pentoxyphenyl)benzoyl]oxynaphthalen-2-yl]hex-5-enoic acid (PubChem CID 70232773) has the molecular formula C34H34O5 and a molecular weight of 522.64 g/mol. Its IUPAC name is 2-[6-[4-(4-pentoxyphenyl)benzoyl]oxynaphthalen-2-yl]hex-5-enoic acid.
| Compound Name | 2-[6-[4-(4-pentoxyphenyl)benzoyl]oxynaphthalen-2-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 70232773 |
| Molecular Formula | C34H34O5 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 2-[6-[4-(4-pentoxyphenyl)benzoyl]oxynaphthalen-2-yl]hex-5-enoic acid |
| SMILES | C=CCCC(C(=O)O)c1ccc2cc(OC(=O)c3ccc(-c4ccc(OCCCCC)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C34H34O5/c1-3-5-7-21-38-30-18-15-25(16-19-30)24-9-11-26(12-10-24)34(37)39-31-20-17-27-22-29(14-13-28(27)23-31)32(33(35)36)8-6-4-2/h4,9-20,22-23,32H,2-3,5-8,21H2,1H3,(H,35,36) |
| InChIKey | DJSAEHBCKLCXFW-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|