C18H21NO7S — CID 66624329
(2S)-2-(6-methoxynaphthalen-2-yl)-5-(2-nitrooxyethylsulfinyl)pentanoic acid (PubChem CID 66624329) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is (2S)-2-(6-methoxynaphthalen-2-yl)-5-(2-nitrooxyethylsulfinyl)pentanoic acid.
| Compound Name | (2S)-2-(6-methoxynaphthalen-2-yl)-5-(2-nitrooxyethylsulfinyl)pentanoic acid |
|---|---|
| PubChem CID | 66624329 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-(6-methoxynaphthalen-2-yl)-5-(2-nitrooxyethylsulfinyl)pentanoic acid |
| SMILES | COc1ccc2cc([C@H](CCCS(=O)CCO[N+](=O)[O-])C(=O)O)ccc2c1 |
| InChI | InChI=1S/C18H21NO7S/c1-25-16-7-6-13-11-15(5-4-14(13)12-16)17(18(20)21)3-2-9-27(24)10-8-26-19(22)23/h4-7,11-12,17H,2-3,8-10H2,1H3,(H,20,21)/t17-,27?/m0/s1 |
| InChIKey | JCIFVGXGRRUCFE-OIGLVOGNSA-N |
| XLogP | 2.75 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|