C23H21NO8 — CID 66624318
(2S)-2-(6-methoxynaphthalen-2-yl)-2-[4-(2-nitrooxyethoxycarbonyl)phenyl]propanoic acid (PubChem CID 66624318) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is (2S)-2-(6-methoxynaphthalen-2-yl)-2-[4-(2-nitrooxyethoxycarbonyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-(6-methoxynaphthalen-2-yl)-2-[4-(2-nitrooxyethoxycarbonyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 66624318 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (2S)-2-(6-methoxynaphthalen-2-yl)-2-[4-(2-nitrooxyethoxycarbonyl)phenyl]propanoic acid |
| SMILES | COc1ccc2cc([C@@](C)(C(=O)O)c3ccc(C(=O)OCCO[N+](=O)[O-])cc3)ccc2c1 |
| InChI | InChI=1S/C23H21NO8/c1-23(22(26)27,19-9-5-17-14-20(30-2)10-6-16(17)13-19)18-7-3-15(4-8-18)21(25)31-11-12-32-24(28)29/h3-10,13-14H,11-12H2,1-2H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | IFIAUVOLJDVUQP-QHCPKHFHSA-N |
| XLogP | 3.60 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|