C17H19NO7 — CID 3257103
2,3-bis(4-methoxyphenoxy)propyl nitrate (PubChem CID 3257103) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenoxy)propyl nitrate.
| Compound Name | 2,3-bis(4-methoxyphenoxy)propyl nitrate |
|---|---|
| PubChem CID | 3257103 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2,3-bis(4-methoxyphenoxy)propyl nitrate |
| SMILES | COc1ccc(OCC(CO[N+](=O)[O-])Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H19NO7/c1-21-13-3-7-15(8-4-13)23-11-17(12-24-18(19)20)25-16-9-5-14(22-2)6-10-16/h3-10,17H,11-12H2,1-2H3 |
| InChIKey | JTHXFNDYUDSLLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|