C24H33NO3 — CID 4958569
2-(2,6-dimethylphenoxy)-N-(4-heptoxyphenyl)propanamide (PubChem CID 4958569) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-(4-heptoxyphenyl)propanamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-(4-heptoxyphenyl)propanamide |
|---|---|
| PubChem CID | 4958569 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-(4-heptoxyphenyl)propanamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)C(C)Oc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C24H33NO3/c1-5-6-7-8-9-17-27-22-15-13-21(14-16-22)25-24(26)20(4)28-23-18(2)11-10-12-19(23)3/h10-16,20H,5-9,17H2,1-4H3,(H,25,26) |
| InChIKey | VZBVEVYNWWHDLX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|