C24H31NO4 — CID 53266719
hexyl 4-[2-(2,3-dimethylphenoxy)propanoylamino]benzoate (PubChem CID 53266719) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is hexyl 4-[2-(2,3-dimethylphenoxy)propanoylamino]benzoate.
| Compound Name | hexyl 4-[2-(2,3-dimethylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 53266719 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | hexyl 4-[2-(2,3-dimethylphenoxy)propanoylamino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)C(C)Oc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-5-6-7-8-16-28-24(27)20-12-14-21(15-13-20)25-23(26)19(4)29-22-11-9-10-17(2)18(22)3/h9-15,19H,5-8,16H2,1-4H3,(H,25,26) |
| InChIKey | KCLWDHNGNKSHNC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|