C22H17FN2O5 — CID 46794981
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methyl-3-nitrobenzoate (PubChem CID 46794981) has the molecular formula C22H17FN2O5 and a molecular weight of 408.39 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 46794981 |
| Molecular Formula | C22H17FN2O5 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)OC(C(=O)Nc2ccc(F)cc2)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17FN2O5/c1-14-7-8-16(13-19(14)25(28)29)22(27)30-20(15-5-3-2-4-6-15)21(26)24-18-11-9-17(23)10-12-18/h2-13,20H,1H3,(H,24,26) |
| InChIKey | PAABZQQPMKNCEB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|