C22H15Cl2F3N2O3 — CID 2386513
[(1R)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-amino-4-chlorobenzoate (PubChem CID 2386513) has the molecular formula C22H15Cl2F3N2O3 and a molecular weight of 483.27 g/mol. Its IUPAC name is [(1R)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [(1R)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 2386513 |
| Molecular Formula | C22H15Cl2F3N2O3 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | [(1R)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)O[C@@H](C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl2F3N2O3/c23-13-6-8-15(18(28)10-13)21(31)32-19(12-4-2-1-3-5-12)20(30)29-14-7-9-17(24)16(11-14)22(25,26)27/h1-11,19H,28H2,(H,29,30)/t19-/m1/s1 |
| InChIKey | RALCWJGZENQMSC-LJQANCHMSA-N |
| XLogP | 6.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|