C27H24ClF3N2O7 — CID 5183522
4-O-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 5183522) has the molecular formula C27H24ClF3N2O7 and a molecular weight of 580.94 g/mol. Its IUPAC name is 4-O-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 5183522 |
| Molecular Formula | C27H24ClF3N2O7 |
| Molecular Weight | 580.94 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 4-O-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C(=O)OC(C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C27H24ClF3N2O7/c1-13-19(24(35)38-3)21(20(14(2)32-13)25(36)39-4)26(37)40-22(15-8-6-5-7-9-15)23(34)33-16-10-11-18(28)17(12-16)27(29,30)31/h5-12,21-22,32H,1-4H3,(H,33,34) |
| InChIKey | JCEGFNZRACOEGM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|