C23H18ClN5O5 — CID 43043023
[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 43043023) has the molecular formula C23H18ClN5O5 and a molecular weight of 479.88 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 43043023 |
| Molecular Formula | C23H18ClN5O5 |
| Molecular Weight | 479.88 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | Cc1nn(C)c2ncc(C(=O)OC(C(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)c3ccccc3)cc12 |
| InChI | InChI=1S/C23H18ClN5O5/c1-13-17-10-15(12-25-21(17)28(2)27-13)23(31)34-20(14-6-4-3-5-7-14)22(30)26-16-8-9-18(24)19(11-16)29(32)33/h3-12,20H,1-2H3,(H,26,30) |
| InChIKey | NKJSZSNMRGVOFF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|