C22H19ClN4O5S — CID 42982616
[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (PubChem CID 42982616) has the molecular formula C22H19ClN4O5S and a molecular weight of 486.94 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 42982616 |
| Molecular Formula | C22H19ClN4O5S |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(C)nc(SCC(=O)OC(C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c2ccccc2)n1 |
| InChI | InChI=1S/C22H19ClN4O5S/c1-13-10-14(2)25-22(24-13)33-12-19(28)32-20(15-6-4-3-5-7-15)21(29)26-16-8-9-17(23)18(11-16)27(30)31/h3-11,20H,12H2,1-2H3,(H,26,29) |
| InChIKey | HSVHJZQQLLDEBH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|