About [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate
[(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate (PubChem CID 37167988) has the molecular formula C24H28N2O4
and a molecular weight of 408.50 g/mol. Its IUPAC name is [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate |
| PubChem CID | 37167988 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate |
| SMILES | CC(=O)N1CCC[C@H](C(=O)O[C@H](C(=O)Nc2cc(C)cc(C)c2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O4/c1-16-12-17(2)14-21(13-16)25-23(28)22(19-8-5-4-6-9-19)30-24(29)20-10-7-11-26(15-20)18(3)27/h4-6,8-9,12-14,20,22H,7,10-11,15H2,1-3H3,(H,25,28)/t20-,22-/m0/s1 |
| InChIKey | KBLXUUVPGJLFDL-UNMCSNQZSA-N |
| XLogP | 3.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate?
The IUPAC name of [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate (CID 37167988) is [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate.
What is the SMILES notation for [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate?
The canonical SMILES for [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate is CC(=O)N1CCC[C@H](C(=O)O[C@H](C(=O)Nc2cc(C)cc(C)c2)c2ccccc2)C1.
What is the InChIKey of [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate?
The InChIKey is KBLXUUVPGJLFDL-UNMCSNQZSA-N. The full InChI is InChI=1S/C24H28N2O4/c1-16-12-17(2)14-21(13-16)25-23(28)22(19-8-5-4-6-9-19)30-24(29)20-10-7-11-26(15-20)18(3)27/h4-6,8-9,12-14,20,22H,7,10-11,15H2,1-3H3,(H,25,28)/t20-,22-/m0/s1.
What are the key properties of [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate?
[(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate has a molecular weight of 408.50 g/mol, XLogP of 3.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (3S)-1-acetylpiperidine-3-carboxylate is sourced from PubChem (CID 37167988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).