C24H25NO3 — CID 98282761
[(1R)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 98282761) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(1R)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [(1R)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 98282761 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(1R)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] (1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | Cc1cc(C)cc(NC(=O)[C@H](OC(=O)[C@@H]2C[C@H]3C=C[C@H]2C3)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25NO3/c1-15-10-16(2)12-20(11-15)25-23(26)22(18-6-4-3-5-7-18)28-24(27)21-14-17-8-9-19(21)13-17/h3-12,17,19,21-22H,13-14H2,1-2H3,(H,25,26)/t17-,19-,21+,22+/m0/s1 |
| InChIKey | ZGEZPJPZEVUSOB-HVJHZFLKSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|