C17H18O4 — CID 101492909
[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 101492909) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 101492909 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | CC(=O)O[C@H](C(=O)O[C@@H]1C[C@H]2C=C[C@@H]1C2)c1ccccc1 |
| InChI | InChI=1S/C17H18O4/c1-11(18)20-16(13-5-3-2-4-6-13)17(19)21-15-10-12-7-8-14(15)9-12/h2-8,12,14-16H,9-10H2,1H3/t12-,14+,15+,16-/m0/s1 |
| InChIKey | CSMOMZZDHMKCAU-XZDPQHSOSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|