C15H16O3 — CID 101492912
[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 101492912) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 101492912 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | O=C(O[C@H]1C[C@H]2C=C[C@@H]1C2)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H16O3/c16-14(11-4-2-1-3-5-11)15(17)18-13-9-10-6-7-12(13)8-10/h1-7,10,12-14,16H,8-9H2/t10-,12+,13-,14-/m0/s1 |
| InChIKey | FGMFPGQJUGAFIJ-GHYVTOPFSA-N |
| XLogP | 2.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|