C16H22NO3+ — CID 4979373
(8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenylacetate (PubChem CID 4979373) has the molecular formula C16H22NO3+ and a molecular weight of 276.36 g/mol. Its IUPAC name is (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenylacetate.
| Compound Name | (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 4979373 |
| Molecular Formula | C16H22NO3+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2-phenylacetate |
| SMILES | C[NH+]1C2CCC1CC(OC(=O)C(O)c1ccccc1)C2 |
| InChI | InChI=1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/p+1 |
| InChIKey | ZTVIKZXZYLEVOL-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |