C14H22N2O4 — CID 174991397
2,6-diamino-7-(2-bicyclo[2.2.1]hept-5-enyloxy)-7-oxoheptanoic acid (PubChem CID 174991397) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2,6-diamino-7-(2-bicyclo[2.2.1]hept-5-enyloxy)-7-oxoheptanoic acid.
| Compound Name | 2,6-diamino-7-(2-bicyclo[2.2.1]hept-5-enyloxy)-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 174991397 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2,6-diamino-7-(2-bicyclo[2.2.1]hept-5-enyloxy)-7-oxoheptanoic acid |
| SMILES | NC(CCCC(N)C(=O)OC1CC2C=CC1C2)C(=O)O |
| InChI | InChI=1S/C14H22N2O4/c15-10(13(17)18)2-1-3-11(16)14(19)20-12-7-8-4-5-9(12)6-8/h4-5,8-12H,1-3,6-7,15-16H2,(H,17,18) |
| InChIKey | SRFFVTJFASAITO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|