C15H26N2O4 — CID 177126650
(2S)-2,6-diamino-7-[(3Z)-cyclooct-3-en-1-yl]oxy-7-oxoheptanoic acid (PubChem CID 177126650) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S)-2,6-diamino-7-[(3Z)-cyclooct-3-en-1-yl]oxy-7-oxoheptanoic acid.
| Compound Name | (2S)-2,6-diamino-7-[(3Z)-cyclooct-3-en-1-yl]oxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 177126650 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S)-2,6-diamino-7-[(3Z)-cyclooct-3-en-1-yl]oxy-7-oxoheptanoic acid |
| SMILES | NC(CCC[C@H](N)C(=O)O)C(=O)OC1C/C=C\CCCC1 |
| InChI | InChI=1S/C15H26N2O4/c16-12(14(18)19)9-6-10-13(17)15(20)21-11-7-4-2-1-3-5-8-11/h2,4,11-13H,1,3,5-10,16-17H2,(H,18,19)/b4-2-/t11?,12-,13?/m0/s1 |
| InChIKey | VWUKLHKQNNKBSV-YDIAZXLISA-N |
| XLogP | 1.33 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|