C25H24N2O4 — CID 2340275
[(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-benzamidoacetate (PubChem CID 2340275) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-benzamidoacetate.
| Compound Name | [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 2340275 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(1S)-2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-benzamidoacetate |
| SMILES | Cc1cc(C)cc(NC(=O)[C@@H](OC(=O)CNC(=O)c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-17-13-18(2)15-21(14-17)27-25(30)23(19-9-5-3-6-10-19)31-22(28)16-26-24(29)20-11-7-4-8-12-20/h3-15,23H,16H2,1-2H3,(H,26,29)(H,27,30)/t23-/m0/s1 |
| InChIKey | QUHGVJNSKJCZDF-QHCPKHFHSA-N |
| XLogP | 3.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |