C25H24N2O5 — CID 16536891
[2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(3-methylbenzoyl)amino]acetate (PubChem CID 16536891) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(3-methylbenzoyl)amino]acetate.
| Compound Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(3-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 16536891 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(3-methylbenzoyl)amino]acetate |
| SMILES | COc1cccc(NC(=O)C(OC(=O)CNC(=O)c2cccc(C)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O5/c1-17-8-6-11-19(14-17)24(29)26-16-22(28)32-23(18-9-4-3-5-10-18)25(30)27-20-12-7-13-21(15-20)31-2/h3-15,23H,16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | YJCUTMQZZLUQTJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |